| VOL. 42B |
NUMBER 7 |
JULY 2003 |
CONTENTS
Rapid Communications |
||
|
1688 |
A convenient enantiospecific methodology for (-)-(1R, 5S)-1,5-dimethylbicyclo[3.3.0]octa-2,7-dione: A formal total synthesis of (-)-ceratopicanol |
An enantiospecific formal total synthesis of the sesquiterpene ceratopicanol is described. |
|
|
|
|
|
|
A Srikrishna*, N Chandrasekhar Babu & Dattatraya H Dethe |
|
|
|
|
|
Papers |
||
|
|
|
|
|
1691 |
Synthesis of Fmoc-/Boc-/Z-β-amino acids via Arndt-Eistert homologation of Fmoc-/Boc-/Z-α-amino acids employing BOP and PyBOP |
A simple and efficient protocol for the synthesis of Fmoc-/Boc-/Z-α-aminod iazoketones using BOP or PyBOP as a coupling agent is described. |
|
|
|
|
|
|
G R Vasanthakumar & V V Suresh Babu* |
|
|
|
|
|
|
1696 |
Facile synthesis of oligonucleotides on solid support using pyridine derivatives for amino and phosphate protection |
The picolinoyl group has been used for amino protection on nucleosides: dC, dA, & dG. The compatibility of this group has been checked during solid phase synthesis of two oligomers, viz. d(TACGTTTTGCT) and d(ACCGATATCGT). The compositions of these oligomers have been confirmed by their enzymatic hydrolysis with SVPD and SPD. |
|
|
Sarika Sinha & Ramendra K Singh* |
|
|
|
|
|
|
|
|
|
|
1701 |
Preparation of 4-(1-alkyl-benzo[d]imidazole-2-yl)-2-phenyl-2,3-dihydrobenzo(b)[1,4]thiazepines |
The preparation of benzimidazolyl-2-benzothiazepins 6 involving the condensation of o-aminothiophenol with benzimidazole chalcone 5 followed by dehydrogenation with Cu(OAc)2/chloranil yielding 4 is described. |
|
|
||
|
|
P K
Dubey*, A Naidu, C Ravi Kumar & |
|
|
|
|
|
|
|
|
|
|
1706 |
Acetoxylation reactions of 17a,21-dichloro-20-oxopregnanes and their relatives |
Acetoxylation reactions of 17a, 21- dichloro -20 –oxopregnanes and their relatives under different conditions using anhydrous sodium and potassium acetate are being studied in order to produce cortisone or triamcinolone side chain. |
|
|
|
|
|
|
Saroj
Hazarika, Papori Goswami & |
|
|
|
|
|
|
1711 |
1H NMR spectral study of some 2,6 –diphenylthian-4-ones and their 1,1-dioxides† |
The uses of Altono’s equation and DAERM method in calculating proton-proton torsional angles have been compared using the vicinal proton-proton coupling constants of three thianes and their corresponding 1,1-dioxides. |
|
|
|
|
|
|
K
Pandiarajan* & |
|
|
|
|
|
|
|
|
|
|
1716 |
The role of orbital symmetry in Bergman cyclization |
AM1 investigation on two model systems show that Bergman cyclization is a symmetry controlled thermally allowed reaction. |
|
|
|
|
|
|
Sandip Kumar Kundu, Twishasri Das Gupta, Suven Das & Animesh Pramanik* |
|
|
|
|
|
|
|
|
|
|
1723 |
Synthesis of some new benzothia/oxazepinyl indoles as an antipsychotic agents |
Several 3-(2¢-substitutedaryl-3¢-substitutedarylaminomethylene-2¢,3¢-dihydro-1¢5¢-benzothia/oxazepin-4¢-yl)indoles and 3-(2¢-substitutedaryl-3¢-substitutedarylazo-2¢,3¢-dihydro-1¢,5¢-benzothia/oxazepin-4¢-yl)indoles have been synthesized and tested for their antipsychotic activity. |
|
|
|
|
|
|
Kiran
Bajaj, V K Srivastava, S Lata, |
|
|
|
|
|
|
|
|
|
|
1729 |
Isoxazolinyl derivatives of anthranilic acid as antiinflammatory agents |
Synthesis of 5-substituted-N-[4¢-(substitutedphenyl)aminoethyl-5¢-(substitutedphenyl)isoxazolin-2¢-yl]anthranilic acids is reported. |
|
|
|
|
|
|
Preeti Rani, V K Srivastava & |
|
|
|
|
|
|
|
|
|
|
1734 |
Synthesis and antibacterial activities of newer derivatives of pyrido[2,3-d; 6,5-d¢]dipyrimidines |
|
|
|
|
|
|
|
R Nandha Kumar, T Suresh & P S Mohan* |
|
|
|
|
|
Notes |
||
|
|
|
|
|
1738 |
Studies in Hantzsch thiazole synthesis: Synthesis of 3-(2-allylamino-4-thiazolyl)-2H-1-benzopyran-2-ones and 3-(4-phenylthiazoline-2-anil)-2H-1-benzopyran-2-ones in solid state |
Interaction of 3-(2-bromoacetyl)coumarins with N-allylthiourea and diphenyl thiourea in solid state furnish corresponding 3-(2-allylamino-4-thiazolyl)-2H-1-benzopyran-2-ones and 3-(4-phenylthiazoline-2-anil)-2H-1-benzopyran-2-ones. |
|
|
|
|
|
|
P Vijaykumar, R Vinod Reddy & |
|
|
|
|
|
|
|
|
|
|
1742 |
A facile one step synthesis of fused isoxazolo-[4,5-b]pyridine-N-oxides |
Reaction of 3,5-dimethyl-4-nitroisoxazole 1 with alkyl and aralkyl ketones gives unexpected and interesting fused isoxazolo[4,5-b]pyridine-N-oxides 2 whose structures could be known only through X-ray diffraction. They are deoxygenated to pyridines 3 by treatment with PCl3. |
|
|
|
|
|
|
T Jagan Mohana Chary, A Krishna Murthy & E Rajanarendar* |
|
|
|
|
|
|
|
|
|
|
1746 |
Synthesis of some novel azetidino [2,3-b] [1,8]naphthyridin-2(1H)-ones and 1,2,4-triazolo [4,3-a][1,8] naphthyridines |
Synthesis of 1-arylazetidino[2,3-b][1,8]naphthyridin-2(1H)-ones 3 and 1-aryl-4-carbethoxy-1,2,4-triazolo [4,3-a][1,8] naphthyridines 6 starting from ethyl 1,8-naphthyridin-2-one-3-carboxylate 1 has been described. |
|
|
|
|
|
|
K
Mogilaiah*, P Raghotham Reddy, |
|
|
|
|
|
|
|
|
|
|
1750 |
Microwave assisted addition-elimination reactions of 3-phenylimino-2-indolinones with 2-hydrazino-3-(p-chlorophenyl)-1,8-naphthyridine: A simple and facile synthesis of 3-(3-p-chlorophenyl-1,8-naphthyridin-2-ylhydrazono)-2-indolinones |
Addition-elimination reactions of 3-phenyl-imino-2-indolinones 2 with 2-hydrazino-3-(p-chlorophenyl)-1,8-naphthyridine 1 under microwave irradiation have been described. |
|
|
||
|
|
K Mogilaiah*, S Kavitha & H Ramesh Babu |
|
|
|
|
|
|
1753 |
Microwave assisted synthesis of pyrazolo[3,4-b]quinolines containing 1,8-naphthyridine moiety |
1,8-Naphthyridinylpyrazolo[3,4-b]quinolines 4 have been synthesized by reaction of 2-hydrazino-3-(4-methoxyphenyl)-1,8-naphthyridine 1 with 2-chloroquinoline-3-carbaldehydes 2 followed by cyclization with DMF/KOH under microwave irradiation. |
|
|
|
|
|
|
K
Mogilaiah*, G Rama Sudhakar & |
|
|
|
|
|
|
|
|
|
|
1756 |
Microwave-assisted synthesis and biological activities of some bridge-head nitrogen heterocycles |
Reaction between 1 and different aromatic aldehydes 2 in the presence of p-TS-OH using microwave irradiation affords the compounds 3a-v. All the products have been evaluated for their antimicrobial activity against several microbes. |
|
|
|
|
|
|
H M
Hirpara, V A Sodha, A M Trivedi, |
|
|
|
|
|
|
|
|
|
|
1760 |
Synthesis of 2-iminothiazolidines through reaction of N-arylsulphonylaziridines with isothiocyanates in the presence of iodide ions |
Reaction of 2-substituted N-arylsulphonylaziridines with isothiocyanates using lithium iodide as a catalyst yields iminothiazolidines. |
|
|
|
|
|
|
U K Nadir* & Susan Joshi |
|
|
|
|
|
|
|
|
|
|
1765 |
Benzimidazolium dichromates :
Efficient reagents for selective oxidation of alcohols |
Oxidation of alcohols with benzimidazolium dichromates in acetic acid at RT results in the formation of carbonyl compounds with good selectivity and high yields. |
|
|
|
|
|
|
K
Ramaiah, P K Dubey*, J Ramanatham , |
|
|
|
|
|
|
|
|
|
|
1768 |
Reductive dicyclization of α,β-unsaturated ketones promoted by Sm and catalysed by HgCl2 |
|
|
|
|
|
|
|
Jiming M Zhang & Yongmin M Zhang* |
|
|
|
|
|
|
|
|
|
|
1771 |
Reductive cleavage of the Te-Te bond in ditellurides by CeCl3/Sm system: A novel method for the synthesis of b-telluroesters (and nitriles) |
Diaryl ditellurides are reduced by CeCl3/Sm system to produce the aryltellurolates which react smoothly with a,b-unsaturated esters (and nitriles) to give b-telluroesters (and nitriles) in moderate to good yields. |
|
|
|
|
|
|
Xue li, Songlin Zhang*, Yulu Wang & Yongmin Zhang |
|
|
|
|
|
|
|
|
|
|
1774 |
Rapid cleavage of azo compounds to amine/s using Raney nickel and ammonium formate or formic acid |
Azo compounds are reductively cleaved to corresponding amine/s catalyzed by Raney nickel using ammonium formate at room temperature. |
|
|
|
|
|
|
D
Channe Gowda*, Shankare Gowda & |
|
|
|
|
|
|
|
|
|
|
1777 |
A rapid and efficient method for acetylation of phenols with acetic anhydride catalysed by TiO2/SO42-solid superacid |
A rapid and efficient method for acetylation of phenols with acetic anhydride in the presence of TiO2/SO42-solid superacid at room or at reflux temperature in excellent yield is described. |
|
|
||
|
|
Yan-Ran Ma, Tong-Shou Jin*, |
|
|
|
|
|
|
|
|
|
|
1779 |
Synthesis and antibacterial activity of amoenylin, a metabolite of Dendrobium amoenum |
Amoenylin 6, has been synthesised from syringaldehyde 1 in three steps with an overall yield of 40%. |
|
|
|
|
|
|
Somepalli Venkateswarlu, |
|
|
|
|
|
|
|
|
|
|
1782 |
Terpenoid and lipid constituents from Artemisia annua |
Two new minor compounds, a bisnor cadinane 1 and the other lipid constituent 3 have been isolated from Artemisia annua. Their structures have been determined by IR, EIMS 1D & 2D NMR and their physicochemical studies. |
|
CH3CH2CH2-CH-CH=CH-CH-CH-(CH2)9-COCH3 OH OH OH
|
||
|
|
Amit Tewari & Rajendra Singh Bhakuni* |
|
|
|
|
|
|
1786 |
Components from whole plant of Phyllanthus amarus Linn |
Secosterols named as amarosterol A, characterized as 13,14-seco-stigma 5(6), 14(15)-diene-3-a-ol 1 and amarosterol B, characterized as 13,14-seco-stigma 9(11), 14(15)-diene-3-a-ol 2 have been isolated from whole plant of Phyllanthus amarus. |
|
|
||
|
|
Bahar Ahmad* & Tanveer Alam |
|
|
Authors for correspondence are indicated by (*) |
||