Total visitors:2,964 since 12-11-03
Sect. B : Organic Chemistry including Medicinal Chemistry
| VOLUME 42B |
NUMBER 11 |
NOVEMBER 2003 |
CONTENTS
Rapid Communications |
||
|
|
|
|
|
2805 |
Ligands and Ru catalysts, Ru DAB, Salen and DMSO complexes catalyzed selective transfer hydrogenation of ketones and aldehydes |
Salen, DAB and DMSO Ru complexes are excellent and selective catalysts for the transfer hydrogenation of ketones and aldehydes using i-C3H7OH as the transfer hydrogenating agent. |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Papers |
|
|
|
|
|
|
2808 |
Synthesis of 4-(1-oxo-isoindoline)-, 4-(5,6-dimethoxy-1-oxo-isoindoline) and 4-acetamido- substituted phenoxy-3-amino-propane derivatives and their b1-, b2-adrenergic receptor binding studies |
The synthesis of 4-(1-oxo-isoindoline)- and 4-(5,6-dimethoxy-1-oxo-isoindoline)-substituted phenoxy-3-amino-propane derivatives and their beta adrenoceptor binding affinity and selectivity in turkey erythrocyte membrane (b1) and lung homogenate of rats (b2) is reported. |
|
|
|
|
|
|
Dharam Paul Jindal, Babita Singh, |
|
|
|
|
|
|
|
|
|
|
2814 |
Selective and efficient heterogeneous hydration of nitriles to amides using silica supported manganese dioxide |
A highly efficient and selective method for hydration of nitriles to amides under heterogeneous reaction condition using silica supported manganese dioxide has been carried out. The method and mechanism of the reaction has been discussed.
|
|
|
|
|
|
|
Bhushan M Khadilkar & |
|
|
|
|
|
|
|
|
|
|
2820 |
Synthesis and crystal structure of 2-[1-phenyl-3-methyl-5-oxo-pyrazol-4-ylidene]-4-methyl-1,5-benzodiazepine |
Synthesis of a new 1,3-difunctionnal synthon derived from pyrazolopyrane, which constitutes an interesting precursor in preparation of new benzodiazepine derivative are reported. |
|
|
|
|
|
|
B
Djerrari, E M Essassi*, J Fifani, |
|
|
|
|
|
|
|
|
|
|
2828 |
Syntheses and QSAR studies of sorbic, cinnamic and ricinoleic acid derivatives as potential antibacterial agents |
Esters and amides of sorbic, cinnamic and ricinoleic acid have been synthesized and evaluated for their antibacterial activity against S. aureus, B. subtilis and E. coli. The QSAR studies in these compounds indicate a major contribution of electronic and steric parameters.
|
|
|
CH3-CH=CH-CH=CH-COOR S1-10 C6H5-CH=CH-COOR C1-10 CH3-(CH2)5-CH(OH)-CH2-CH2-CH=CH-(CH2)7COOR R1,4.
|
|
|
|
B
Narasimhan, U R Kothawade, |
|
|
|
|
|
|
|
|
|
|
2835 |
Synthesis and antimicrobial activities of some quinoxalinonyl amino acid and peptide derivatives |
The synthesis and antimicrobial screening of some 3-methyl-2(1H)-quinoxalinon-1-yl acetyl amino acid, peptide, diamine,thiazolyl and benzothiazolyl derivatives, in addition to three copper complexes, have been described. The synthesized compounds have been screened against E.coli, P. aeroginosa, S. aureus and B.subtilis. It is noteworthy, to mention that, the complex formation enhance considerably the antimicrobial action.
|
|
|
|
|
|
|
A Y Ali, EzzEl-Din M Salem, J A Hasananen & M E Abdel-Fattah* |
|
|
|
|
|
|
|
|
|
|
2846 |
Synthesis and anti-proliferative activity in vitro of new 5-(2-amino-3-pyridyl)-2-thioxo-3H-1,3,4- oxadiazole derivatives |
Reaction of 5-(2-amino-3-pyridyl)- 2-ethoxy-carbonylthio-1,3,4-oxadiazole 5 with some primary and secondary amines under different conditions leads to the formation of aryl-(cycloalkyl-, aryl)-amincarbamylmethylthio- 6-10 or aryl-(cycloalkyl-, aryl)-amino- 11-16. Selected compounds have been tested for their biological activity. |
|
|
|
|
|
|
H Liszkiewicz*, M W Kowalska, J Wietrzyk & A Opolski |
|
|
|
|
|
|
|
|
|
|
2853 |
Evaluation of some new 1,3-disubstituted 2-thioxo-4,5-imidazolidinediones as hypnotic agents |
Nineteen new imidazolidinedione derivatives are synthesized and their structures are determined by the elemental analyses and spectral data (IR, 1H NMR, EIMS). Hypnotic activities of the compounds are reported.
|
|
|
R= C6H5, 4-CH3C6H4, 4-FC6H4, 4-ClC6H4, 4-BrC6H4, 4-NO2C6H4, C6H11, R1= C6H5, R2= 4-CH3C6H4, 3-CH3C6H4, 2-ClC6H4, 4-NO2C6H4, 2-NO2C6H4, 4-COOHC6H4, 2,5-(OH)BrC6H3, 3,4-(OCH3)(OH)C6H3, 3,4-(OCH2O)C6H3, 3,4-(OCH3)2C6H3, 5-nitro-2-furyl
|
|
|
|
N Ulusoy*, E Gürsu, S Özkırımlı, A C Ekinci & İ Dikici |
|
|
|
|
|
|
|
|
|
|
2858 |
Isolation of some novel phytoconstituents from Anaphalis araneosa roots |
The roots of Anaphalis araneosa DC. (Asteraceae) contain 3b-hydroxyolean-12-en-30-oic acid (anaphalisoleanenoic), 5,9,13-trimethyl-eicos-5-en-17,18-diol-24-oic acid (anaphalisoic acid) and bisabol-1 (7)- 2, 4 (13), 11 (12)-tetraen-15-ol-14-oic acid (araneosoic acid).
|
|
|
|
|
|
|
S K Sharma, M Ali* & S R Mir |
|
|
|
||
Notes |
||
|
|
|
|
|
2863 |
A single step preparation of p-sulphonated calixarenes |
Calix[n]arene sulphonic acids (n=4, 6, 8) have been prepared by direct ipso-substitution of respective p-tert-butylcalix[n]arenes and their methyl ethers.
|
|
|
||
|
|
Satish Kumar, H M Chawla & |
|
|
|
|
|
|
|
|
|
|
2866 |
Stereoselective formation of steroidal (6R)-spiro oxazolidines |
Reaction of steroidal -6- ketones 1-3 with R(-)-2-amino butanol in the presence of p-TsOH afford selectively respective steroidal (6R) – spiro oxazolidines 4-6.
|
|
|
1-3 4-6 1, 4 R = OAc2, 5 R = Cl3, 6 R = H
|
|
|
|
Kamlesh Sharma, Kishwar Saleem* & Anwar Salim |
|
|
|
|
|
|
|
|
|
|
2869 |
Synthesis of new steroidal oxime-ether derivatives |
Reaction of steroidal keto oximes 1-3 with chloroethylamine hydrochloride in the presence of sodium methoxide afford aminoethoxyiminocholestenes 4 - 6.
|
|
|
|
|
|
|
Shamsuzzaman*, Anwar Salim, |
|
|
|
|
|
|
|
|
|
|
2872 |
Synthesis of new steroidal oxazoles and thiazoles |
Reaction of steroidal
a-bromoketones
1-3
with urea and thiourea, separately in ethanol afford steriodal oxazoles
|
|
|
1-3 4-9 X=O,S |
|
|
|
Shamsuzzaman, Anwar Salim, |
|
|
|
|
|
|
|
|
|
|
2875 |
|
N-Arylsulphonylaziridines react with propyl, benzyl and benzoyl isocyanates in the presence of LiI to give improved yield of the corresponding 2-imidazolidinones. |
|
|
R= Propyl, benzyl, benzoyl
|
|
|
|
U K Nadir* & Susan Joshi |
|
|
|
|
|
|
|
|
|
|
2878 |
Solid phase reduction of oxazolones using BER-Ni2B ¾ A simple synthesis of N-benzoylphenylalanines |
Borohydride exchange resin (BER)-Ni2B is successfully used as a reagent for the solid phase reduction of the C-4 exocyclic double bond of oxazolones to give the N-benzoylphenylalanines and hence the corresponding amino acids. |
|
|
|
|
|
|
Atul P Sikdar, Ajoy B Chetri & |
|
|
|
|
|
|
|
|
|
|
2882 |
Magnesium/ ammonium formate promoted rapid, low-cost and selective reduction of nitro compounds |
Nitro compounds are selectively and rapidly reduced to their corresponding amines in the presence of other functional groups, by employing magnesium powder and ammonium formate. |
|
|
R-NO2
R= alkyl or aryl |
|
|
|
||
|
|
G
R Srinivasa, K Abiraj & |
|
|
|
|
|
|
|
|
|
|
2885 |
Hydrazine/magnesium mediated cost-effective and selective reduction of nitro compounds |
Magnesium catalyzed reduction of both aliphatic and aromatic nitro compounds using hydrazine is described. |
|
|
R= alkyl or aryl |
|
|
|
G
R Srinivasa, K Abiraj & |
|
|
|
|
|
|
|
|
|
|
2888 |
RuCl3, a mild and efficient catalyst for tetrahydropyranylation of alcohols and deprotection of tetrahydropyranyl ethers |
RuCl3 in dry acetonitrile catalyzes efficiently tetrahydropyranylation of different types of alcohols to afford the corresponding tetrahydropyranyl ethers in high yields. Deprotection of tetrahydropyranyl ethers can also be achieved efficiently in the presence anhydrous ruthenium trichloride in wet acetonitrile |
|
|
|
|
|
|
F Kazemi*, A R Kiasat* & S Ebrahimi |
|
|
|
|
|
|
|
|
|
|
2890 |
A rapid method for oxidative deprotection of trimethylsilyl ether with wet alumina supported Dess-Martin periodinance in solventless system under microwave irradiation |
|
|
|
|
|
|
|
S
Hossein Abdi Oskooie*, Majid M Heravi, Noohshin Sarmad, Akbar Saednia & |
|
|
|
|
|
|
|
|
|
|
2892 |
Microwave-assisted synthesis and antimicrobial activity of some new thiazolidinones |
The synthesis of 4a-m have been accomplished by treating 4-[5-(4-oxo-3-phenyl-2-phenyliminothiazolidin-5-ylidenemethyl)furan-2-yl]benzoic acid in the presence of ammonium acetate under microwave irradiation. All the products have been evaluated in vitro for antimicrobial activity. |
|
|
4 a-m R=Aryl
|
|
|
|
V
A Sodha, H M Hirpara, A M Trivedi, |
|
|
|
|
|
|
|
|
|
|
2896 |
Synthesis and antimicrobial activity of some new 1-cyclohexyl-3-carbethoxy-2-methyl-5-oxadiazolyl/triazolyl and pyrrolylaminocarbonylmethoxyindoles |
|
|
|
|
|
|
|
Guru S Gadaginamath* & Shashikant R Pujar
|
|
|
2901 |
Synthesis of biologically active 5-benzopyranylpyridines and triazolopyridines |
The facile synthesis of 5-benzopyranylpyridine and triazolopyridine derivatives from chalcones of 4-hydroxycoumarin is discussed. |
![]() |
||
|
V V Mulwad* & Rupesh B Pawar |
||
|
2905 |
Two new pentacyclic triterpene glycosides from the bark of Terminalia arjuna |
The structures of two new pentacyclic triterpenoid glycosides have been characterized as olean-3a, 22b-diol-12-en-28-oic acid-3-O-b-d-glucopyranosyl (1®4)-b-d-glucopyranside 1 and olean-3b, 6b,22a-triol-12-en-28-oic acid-3-O-b-d-glucopyranosyl(1®4)-b-d-glucopyranoside 2, on the basis of spectral data analyses and chemical studies. |
|
1 2 |
||
| Asif Ali, S Tarique Abdullah, Hinna Hamid, Mohammed Ali* & M S Alam | ||
|
Authors for correspondence are indicated by (*) |
||